Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ACY-738 is a potent and selective HDAC6 inhibitor with improved brain bioavailability. ACY-738 inhibits HDAC6 with low nanomolar potency and a selectivity of 60- to 1500-fold over class I HDACs. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15934 |
|---|---|
| Formula | C14H14N4O2 |
| Molecular Weight | 270.29 |
| CAS Number | 1375465-91-0 |
| SMILES | O=C(C1=CN=C(NC2(C3=CC=CC=C3)CC2)N=C1)NO |
| Synonyms | ACY 738, ACY738 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (170.18 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (3.69 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37 mL | 184.99 mL | 369.97 mL |
| 0.5 mM | 7.4 mL | 37 mL | 73.99 mL |
| 1 mM | 3.7 mL | 18.5 mL | 37 mL |
| 5 mM | 0.74 mL | 3.7 mL | 7.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
