Loading distributor info...
| Description | Mirin prevents ATM activation in response to double strand breaks (IC50 = 12 uM) and induces G2 cell cycle arrest. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15842 |
|---|---|
| Formula | C10H8N2O2S |
| Molecular Weight | 220.25 |
| CAS Number | 1198097-97-0 |
| SMILES | O=C1NC(S/C1=C\C2=CC=C(O)C=C2)=N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (190.69 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 45.4 mL | 227.01 mL | 454.03 mL |
| 0.5 mM | 9.08 mL | 45.4 mL | 90.81 mL |
| 1 mM | 4.54 mL | 22.7 mL | 45.4 mL |
| 5 mM | 0.91 mL | 4.54 mL | 9.08 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
