Loading distributor info...
| Description | RG2833 ( is a brain-penetrant HDAC inhibitor with IC50 of 60 nM and 50 nM for HDAC1 and HDAC3. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13139 |
|---|---|
| Formula | C20H25N3O2 |
| Molecular Weight | 339.43 |
| CAS Number | 1215493-56-3 |
| SMILES | CC1=CC=C(C=C1)C(=O)NCCCCCC(=O)NC2=CC=CC=C2N |
| Synonyms | RGFP109 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (191.49 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL (29.46 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.46 mL | 147.31 mL | 294.61 mL |
| 0.5 mM | 5.89 mL | 29.46 mL | 58.92 mL |
| 1 mM | 2.95 mL | 14.73 mL | 29.46 mL |
| 5 mM | 0.59 mL | 2.95 mL | 5.89 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
