Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 1-Azakenpaullone is a potent and selective GSK-3β inhibitor with IC50 of 18 nM, >100-fold selectivity over CDK1/cyclin B and CDK5/p25. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14303 |
|---|---|
| Formula | C15H10BrN3O |
| Molecular Weight | 328.16 |
| CAS Number | 676596-65-9 |
| SMILES | C1C2=C(C3=C(C=CC=N3)NC1=O)NC4=C2C=C(C=C4)Br |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (176.74 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.47 mL | 152.36 mL | 304.73 mL |
| 0.5 mM | 6.09 mL | 30.47 mL | 60.95 mL |
| 1 mM | 3.05 mL | 15.24 mL | 30.47 mL |
| 5 mM | 0.61 mL | 3.05 mL | 6.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
