Loading distributor info...
| Description | 3,3'-Diindolylmethane(DIM) is a major digestive product of indole-3-carbinol, a potential anticancer component of cruciferous vegetables. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A16321 |
|---|---|
| Formula | C17H14N2 |
| Molecular Weight | 246.31 |
| CAS Number | CAS: 1968-05-4 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC3=CNC4=CC=CC=C43 |
| Synonyms | DIM, Arundine, HB 236 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (182.69 mM) | |
| Water | Insoluble | ||
| Ethanol | 17 mg/mL (69.01 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.6 mL | 203 mL | 405.99 mL |
| 0.5 mM | 8.12 mL | 40.6 mL | 81.2 mL |
| 1 mM | 4.06 mL | 20.3 mL | 40.6 mL |
| 5 mM | 0.81 mL | 4.06 mL | 8.12 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
