Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 3-Methylxanthine, a xanthine derivative, is a cyclic guanosine monophosphate (GMP) inhibitor, with an IC50 of 920 μM on guinea-pig isolated trachealis muscle. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20609 |
|---|---|
| Formula | C6H6N4O2 |
| Molecular Weight | 166.14 |
| CAS Number | 1076-22-8 |
| SMILES | O=C1N(C)C2=C(N=CN2)C(N1)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 8 mg/mL (48.15 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 60.19 mL | 300.95 mL | 601.9 mL |
| 0.5 mM | 12.04 mL | 60.19 mL | 120.38 mL |
| 1 mM | 6.02 mL | 30.1 mL | 60.19 mL |
| 5 mM | 1.2 mL | 6.02 mL | 12.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
