Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | 4-Methylumbelliferone is a selective inhibitor of Hyaluronan (HA) synthesis which is thought to function as an inhibitor via the depletion of UDP-glucuronic acid, the common substrate for HA synthesis. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10015 |
|---|---|
| Formula | C10H8O3 |
| Molecular Weight | 176.2 |
| CAS Number | 90-33-5 |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O |
| Synonyms | 4-MU |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 30 mg/mL (170.29 mM) | |
| Water | Insoluble | ||
| Ethanol | 30 mg/mL (170.29 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 56.75 mL | 283.77 mL | 567.54 mL |
| 0.5 mM | 11.35 mL | 56.75 mL | 113.51 mL |
| 1 mM | 5.68 mL | 28.38 mL | 56.75 mL |
| 5 mM | 1.14 mL | 5.68 mL | 11.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
