Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 4E1RCat is a dual inhibitor of eIF4E:eIF4G and eIF4E:4E-BP1 interaction. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14301 |
|---|---|
| Formula | C28H18N2O6 |
| Molecular Weight | 478.45 |
| CAS Number | 328998-25-0 |
| SMILES | C1=CC=C(C=C1)C2=C/C(=C/C3=CC=C(O3)C4=CC=C(C=C4)[N+](=O)[O-])/C(=O)N2C5=CC=C(C=C5)C(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (175.56 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.9 mL | 104.5 mL | 209.01 mL |
| 0.5 mM | 4.18 mL | 20.9 mL | 41.8 mL |
| 1 mM | 2.09 mL | 10.45 mL | 20.9 mL |
| 5 mM | 0.42 mL | 2.09 mL | 4.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
