Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 5,6,7-Trimethoxyflavone is a novel p38-α MAPK inhibitor with an anti-inflammatory effect. 5,6,7-Trimethoxyflavone is isolated from several plants including Zeyhera tuberculosa, Callicarpa japonica, and Kickxia lanigera. |
|---|
| Catalog Num | A19612 |
|---|---|
| Formula | C18H16O5 |
| Molecular Weight | 312.32 |
| CAS Number | 973-67-1 |
| SMILES | O=C1C=C(C2=CC=CC=C2)OC3=CC(OC)=C(OC)C(OC)=C13 |
| Synonyms | Baicalein trimethyl ether |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (28.81 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.02 mL | 160.09 mL | 320.18 mL |
| 0.5 mM | 6.4 mL | 32.02 mL | 64.04 mL |
| 1 mM | 3.2 mL | 16.01 mL | 32.02 mL |
| 5 mM | 0.64 mL | 3.2 mL | 6.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
