Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | 6-thio-dG is a nucleoside analog and telomerase substrate. |
|---|
| Catalog Num | A15894 |
|---|---|
| Formula | C10H13N5O3S |
| Molecular Weight | 283.31 |
| CAS Number | 789-61-7 |
| SMILES | N=C1NC2=C(N=CN2[C@@]3([H])C[C@@](O)([H])[C@@](O3)([H])CO)C(S)=N1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (176.48 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.3 mL | 176.49 mL | 352.97 mL |
| 0.5 mM | 7.06 mL | 35.3 mL | 70.59 mL |
| 1 mM | 3.53 mL | 17.65 mL | 35.3 mL |
| 5 mM | 0.71 mL | 3.53 mL | 7.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
