Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | A 438079 Hcl is a competitive P2X7 receptor antagonist (pIC50 = 6.9 for the inhibition of Ca2+ influx in the human recombinant P2X7 cell line). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14983 |
|---|---|
| Formula | C13H10Cl3N5 |
| Molecular Weight | 342.61 |
| CAS Number | 899431-18-6 |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NN=NN2CC3=CN=CC=C3.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 55 mg/mL (160.53 mM) | |
| Water | 55 mg/mL (160.53 mM) | ||
| Ethanol | Warmed: 18 mg/mL (52.53 mM) | ||
| In vivo | Saline | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.19 mL | 145.94 mL | 291.88 mL |
| 0.5 mM | 5.84 mL | 29.19 mL | 58.38 mL |
| 1 mM | 2.92 mL | 14.59 mL | 29.19 mL |
| 5 mM | 0.58 mL | 2.92 mL | 5.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
