Loading distributor info...
| Description | A1874 is a nutlin-based and BRD4-degrading PROTAC with a DC50 of 32 nM (induce BRD4 degradation in cells). Effective in inhibiting many cancer cell lines proliferation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18735 |
|---|---|
| Formula | C58H62Cl3F2N9O7S |
| Molecular Weight | 1173.6 |
| CAS Number | 2064292-12-0 |
| SMILES | CC1=C(SC2=C1C(=N[C@H](C3=NN=C(N32)C)CC(=O)NCCOCCOCCOCCNC(=O)C4=CC(=C(C=C4)NC(=O)[C@H]5[C@@H]([C@@]([C@@H](N5)CC(C)(C)C)(C#N)C6=C(C=C(C=C6)Cl)F)C7=C(C(=CC=C7)Cl)F)OC)C8=CC=C(C=C8)Cl)C |
| Synonyms | A1874, A-1874 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (78.38 mM) | |
| Water | Insoluble | ||
| Ethanol | 92 mg/mL (78.38 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 8.52 mL | 42.6 mL | 85.21 mL |
| 0.5 mM | 1.7 mL | 8.52 mL | 17.04 mL |
| 1 mM | 0.85 mL | 4.26 mL | 8.52 mL |
| 5 mM | 0.17 mL | 0.85 mL | 1.7 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
