Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ABT333 is an NS5B non-nucleoside polymerase inhibitor. |
|---|
| Catalog Num | A13878 |
|---|---|
| Formula | C26H27N3O5S |
| Molecular Weight | 493.57 |
| CAS Number | 1132935-63-7 |
| SMILES | CC(C)(C)C1=C(C(=CC(=C1)N2C=CC(=O)NC2=O)C3=CC4=C(C=C3)C=C(C=C4)NS(=O)(=O)C)OC |
| Synonyms | ABT 333, ABT-333 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (182.34 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.26 mL | 101.3 mL | 202.61 mL |
| 0.5 mM | 4.05 mL | 20.26 mL | 40.52 mL |
| 1 mM | 2.03 mL | 10.13 mL | 20.26 mL |
| 5 mM | 0.41 mL | 2.03 mL | 4.05 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
