Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Acalisib is an inhibitor of the beta and delta isoforms of the 110 kDa catalytic subunit of class IA phosphoinositide-3 kinases (PI3K) with potential immunomodulating and antineoplastic activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14441 |
|---|---|
| Formula | C21H16FN7O |
| Molecular Weight | 401.4 |
| CAS Number | 870281-34-8 |
| SMILES | CC(C1=NC2=C(C=C(C=C2)F)C(=O)N1C3=CC=CC=C3)NC4=NC=NC5=C4NC=N5 |
| Synonyms | GS-9820 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (189.34 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.91 mL | 124.56 mL | 249.13 mL |
| 0.5 mM | 4.98 mL | 24.91 mL | 49.83 mL |
| 1 mM | 2.49 mL | 12.46 mL | 24.91 mL |
| 5 mM | 0.5 mL | 2.49 mL | 4.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
