Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Acelarin (NUC-1031) is a ProTide transformation and enhancement of the widely-used nucleoside analogue, gemcitabine. |
|---|
| Catalog Num | A20397 |
|---|---|
| Formula | C25H27F2N4O8P |
| Molecular Weight | 580.47 |
| CAS Number | 840506-29-8 |
| SMILES | O=C1N=C(N)C=CN1[C@@H]2O[C@H](COP(OC3=CC=CC=C3)(N[C@H](C(OCC4=CC=CC=C4)=O)C)=O)[C@@H](O)C2(F)F |
| Synonyms | NUC-1031, NUC1031, NUC 1031 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (165.38 mM) | |
| Water | Insoluble | ||
| Ethanol | 19 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.23 mL | 86.14 mL | 172.27 mL |
| 0.5 mM | 3.45 mL | 17.23 mL | 34.45 mL |
| 1 mM | 1.72 mL | 8.61 mL | 17.23 mL |
| 5 mM | 0.34 mL | 1.72 mL | 3.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
