Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Aclidinium Bromide(LAS 34273; LAS-W 330) is a long-acting, inhaled muscarinic antagonist as a maintenance treatment for chronic obstructive pulmonary disease (COPD). |
|---|
| Catalog Num | A21936 |
|---|---|
| Formula | C26H30BrNO4S2 |
| Molecular Weight | 564.55 |
| CAS Number | 320345-99-1 |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOC3=CC=CC=C3)CCC1CC2)C(C4=CC=CS4)(O)C5=CC=CS5.[Br-] |
| Synonyms | LAS 34273, LAS-34273, LAS-34273; LAS-W 330, LAS-W330, LAS-W-330 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 105 mg/mL (185.98 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.71 mL | 88.57 mL | 177.13 mL |
| 0.5 mM | 3.54 mL | 17.71 mL | 35.43 mL |
| 1 mM | 1.77 mL | 8.86 mL | 17.71 mL |
| 5 mM | 0.35 mL | 1.77 mL | 3.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
