Signaling Pathway
RET/RAF/SRC/S6K inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AD80, a multikinase inhibitor, inhibits RET, RAF,SRCand S6K, with greatly reduced mTOR activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19332 |
|---|---|
| Formula | C22H19F4N7O |
| Molecular Weight | 473.43 |
| CAS Number | 1384071-99-1 |
| SMILES | O=C(NC1=CC(C(F)(F)F)=CC=C1F)NC2=CC=C(C3=NN(C(C)C)C4=NC=NC(N)=C43)C=C2 |
| Synonyms | AD 80, AD-80 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 91 mg/mL (192.21 mM) | |
| Water | Insoluble | ||
| Ethanol | 91 mg/mL | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.12 mL | 105.61 mL | 211.22 mL |
| 0.5 mM | 4.22 mL | 21.12 mL | 42.24 mL |
| 1 mM | 2.11 mL | 10.56 mL | 21.12 mL |
| 5 mM | 0.42 mL | 2.11 mL | 4.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
