Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AL082D06 is a nonsteroidal glucocorticoid receptor antagonist. |
|---|
| Catalog Num | A12194 |
|---|---|
| Formula | C23H24ClN3O2 |
| Molecular Weight | 409.91 |
| CAS Number | 256925-03-8 |
| SMILES | CN(C)C1=CC=C(C=C1)C(C2=CC=C(C=C2)N(C)C)C3=C(C=CC(=C3)[N+](=O)[O-])Cl |
| Synonyms | AL-082D06, AL 082D06, D-06 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (21.95 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.4 mL | 121.98 mL | 243.96 mL |
| 0.5 mM | 4.88 mL | 24.4 mL | 48.79 mL |
| 1 mM | 2.44 mL | 12.2 mL | 24.4 mL |
| 5 mM | 0.49 mL | 2.44 mL | 4.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
