Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Apixaban is an anticoagulant for the prevention of venous thromboembolism and venous thromboembolic events. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10082 |
|---|---|
| Formula | C25H25N5O4 |
| Molecular Weight | 459.5 |
| CAS Number | 503612-47-3 |
| SMILES | COC1=CC=C(C=C1)N2C3=C(CCN(C3=O)C4=CC=C(C=C4)N5CCCCC5=O)C(=N2)C(=O)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 17 mg/mL (36.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG 400+0.5% Tween 80+5% Propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.76 mL | 108.81 mL | 217.63 mL |
| 0.5 mM | 4.35 mL | 21.76 mL | 43.53 mL |
| 1 mM | 2.18 mL | 10.88 mL | 21.76 mL |
| 5 mM | 0.44 mL | 2.18 mL | 4.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
