Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Apoptosis Activator 2 strongly induces caspase-3 activation, PARP cleavage, and DNA fragmentation which leads to the destruction of cells (Apaf-1 dependent) with IC50 of ~4 μM, inactive to HMEC, PREC, or MCF-10A cells | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11944 |
|---|---|
| Formula | C15H9Cl2NO2 |
| Molecular Weight | 306.1 |
| CAS Number | 79183-19-0 |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)N2CC3=CC(=C(C=C3)Cl)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (173.12 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.67 mL | 163.35 mL | 326.69 mL |
| 0.5 mM | 6.53 mL | 32.67 mL | 65.34 mL |
| 1 mM | 3.27 mL | 16.33 mL | 32.67 mL |
| 5 mM | 0.65 mL | 3.27 mL | 6.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
