Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | ARRY334543 is a potent, orally active small molecule inhibitor of EGFR and ErbB-2. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11158 |
|---|---|
| Formula | C22H19ClN6O2S |
| Molecular Weight | 466.94 |
| CAS Number | 845272-21-1 |
| SMILES | C[C@@H]1COC(=N1)NC2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=NC=CS5)Cl |
| Synonyms | ARRY-334543, Varlitinib |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 6 mg/mL (12.84 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.42 mL | 107.08 mL | 214.16 mL |
| 0.5 mM | 4.28 mL | 21.42 mL | 42.83 mL |
| 1 mM | 2.14 mL | 10.71 mL | 21.42 mL |
| 5 mM | 0.43 mL | 2.14 mL | 4.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
