Loading distributor info...
| Description | AS-252424 is a potent inhibitor of PI3K with selectivity for the γ isoform. It inhibits human recombinant PI3Kγ, α, β, and δ with IC50 values of 30, 940, 20,000, and 20,000 nM respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11099 |
|---|---|
| Formula | C14H8FNO4S |
| Molecular Weight | 305.3 |
| CAS Number | 900515-16-4 |
| SMILES | C1=CC(=C(C=C1F)O)C2=CC=C(O2)/C=C\3/C(=O)NC(=O)S3 |
| Synonyms | AS252424 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 57 mg/mL (186.71 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+50% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.75 mL | 163.77 mL | 327.55 mL |
| 0.5 mM | 6.55 mL | 32.75 mL | 65.51 mL |
| 1 mM | 3.28 mL | 16.38 mL | 32.75 mL |
| 5 mM | 0.66 mL | 3.28 mL | 6.55 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
