Loading distributor info...
| Description | AS101, a potent in vitro and in vivo immunomodulator, is a novel inhibitor of IL-1beta converting enzyme. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16414 |
|---|---|
| Formula | C2H4Cl3O2Te.H4N |
| Molecular Weight | 312.05 |
| CAS Number | 106566-58-9 |
| SMILES | C1CO[Te](O1)(Cl)(Cl)Cl.[NH4+] |
| Synonyms | CTK8E8213, RT-011323 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (185.86 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.05 mL | 160.23 mL | 320.46 mL |
| 0.5 mM | 6.41 mL | 32.05 mL | 64.09 mL |
| 1 mM | 3.2 mL | 16.02 mL | 32.05 mL |
| 5 mM | 0.64 mL | 3.2 mL | 6.41 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
