Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ASP9521 is a novel, selective, orally bioavailable inhibitor of 17??-hydroxysteroid dehydrogenase type 5 (17bHSD5, AKR1C3). |
|---|
| Catalog Num | A14412 |
|---|---|
| Formula | C19H26N2O3 |
| Molecular Weight | 330.42 |
| CAS Number | 1126084-37-4 |
| SMILES | O=C(N1CCC(CC(C)(O)C)CC1)C(N2)=CC3=C2C=CC(OC)=C3 |
| Synonyms | ASP-9521, ASP 9521, AKR1C3 inhibitor, 17??HSD5 inhibitor |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (196.71 mM) | |
| Water | Insoluble | ||
| Ethanol | 65 mg/mL (196.71 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.26 mL | 151.32 mL | 302.65 mL |
| 0.5 mM | 6.05 mL | 30.26 mL | 60.53 mL |
| 1 mM | 3.03 mL | 15.13 mL | 30.26 mL |
| 5 mM | 0.61 mL | 3.03 mL | 6.05 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
