Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Atglistatin is a highly potent, selective and competitive inhibitor of adipose triglyceride lipase (ATGL) with an IC50 of ~0.7 μM for inhibition of lipolysis in vitro, but no toxicity up to a concentration of 50 μM. |
|---|
| Catalog Num | A13814 |
|---|---|
| Formula | C17H21N3O |
| Molecular Weight | 283.16 |
| CAS Number | 1469924-27-3 |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC(=CC=C2)NC(=O)N(C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (194.09 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (14.11 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.32 mL | 176.58 mL | 353.16 mL |
| 0.5 mM | 7.06 mL | 35.32 mL | 70.63 mL |
| 1 mM | 3.53 mL | 17.66 mL | 35.32 mL |
| 5 mM | 0.71 mL | 3.53 mL | 7.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
