Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Atuveciclib, also known as BAY1143572, is a highly selective, potent and orally available inhibitor of PTEFb/CDK9 currently in Phase I. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16810 |
|---|---|
| Formula | C18H18FN5O2S |
| Molecular Weight | 387.43 |
| CAS Number | 1414943-88-6 |
| SMILES | O=S(C)(CC1=CC=CC(NC2=NC(C3=CC=C(F)C=C3OC)=NC=N2)=C1)=N |
| Synonyms | BAY 1143572, BAY-1143572 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 69 mg/mL (178.09 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.81 mL | 129.06 mL | 258.11 mL |
| 0.5 mM | 5.16 mL | 25.81 mL | 51.62 mL |
| 1 mM | 2.58 mL | 12.91 mL | 25.81 mL |
| 5 mM | 0.52 mL | 2.58 mL | 5.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
