Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Aurora Kinase Inhibitor 3 is a strong and selective Aurora A kinase inhibitor with an IC50 of 42 nM, and weakly inhibits EGFR with an IC50>10 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19448 |
|---|---|
| Formula | C21H18F3N5O |
| Molecular Weight | 413.4 |
| CAS Number | 879127-16-9 |
| SMILES | O=C(C1CC1)NC2=CC=CC(NC3=NC=CC(NC4=CC=CC(C(F)(F)F)=C4)=N3)=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 82 mg/mL (198.35 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (12.09 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.19 mL | 120.95 mL | 241.9 mL |
| 0.5 mM | 4.84 mL | 24.19 mL | 48.38 mL |
| 1 mM | 2.42 mL | 12.09 mL | 24.19 mL |
| 5 mM | 0.48 mL | 2.42 mL | 4.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
