Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AUY922 (NVP-AUY922) is highly potent and oral inhibitor of Hsp90 with IC50=21 nM in Hsp90 FP binding assay and inhibits proliferation of various human cancer cell lines in vitro, with GI50 average 9 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10659 |
|---|---|
| Formula | C26H31N3O5 |
| Molecular Weight | 465.5 |
| CAS Number | 747412-49-3 |
| SMILES | CCNC(=O)C1=C(/C(=C/2\C=C(C(=CC2=O)O)C(C)C)/ON1)C3=CC=C(C=C3)CN4CCOCC4 |
| Synonyms | VER-52296, AUY-922 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 86 mg/mL (184.72 mM) | |
| Water | Insoluble | ||
| Ethanol | 29 mg/mL (62.28 mM) | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.48 mL | 107.41 mL | 214.82 mL |
| 0.5 mM | 4.3 mL | 21.48 mL | 42.96 mL |
| 1 mM | 2.15 mL | 10.74 mL | 21.48 mL |
| 5 mM | 0.43 mL | 2.15 mL | 4.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
