Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZ33 is a LDHA Inhibitor. |
|---|
| Catalog Num | A13341 |
|---|---|
| Formula | C25H27N3O6S |
| Molecular Weight | 497.56 |
| CAS Number | 1370290-34-8 |
| SMILES | CC1=NC2=C(S1)C=C(C=C2)NC(=O)CCNC(=O)CCCC3=CC=C(C=C3)CC(C(=O)O)C(=O)O |
| Synonyms | AZ 33, AZ33 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (172.84 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.1 mL | 100.49 mL | 200.98 mL |
| 0.5 mM | 4.02 mL | 20.1 mL | 40.2 mL |
| 1 mM | 2.01 mL | 10.05 mL | 20.1 mL |
| 5 mM | 0.4 mL | 2.01 mL | 4.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
