Azaindole 1 (BAY-549) is a highly potent inhibitor of human ROCK-1 and ROCK-2 isoenzymes with IC50 values of 0.6 and 1.1 nM, respectively.
Loading distributor info...
| Description | Azaindole 1 (BAY-549) is a highly potent inhibitor of human ROCK-1 and ROCK-2 isoenzymes with IC50 values of 0.6 and 1.1 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15225 |
|---|---|
| Formula | C18H13ClF2N6O |
| Molecular Weight | 402.79 |
| CAS Number | 867017-68-3 |
| SMILES | CC1=CNC2=NC=CC(=C12)OC3=C(C=C(C=C3F)NC4=CC(=NC(=N4)N)Cl)F |
| Synonyms | ROCK-IN-2; TC-S 7001 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (191.16 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (4.96 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.83 mL | 124.13 mL | 248.27 mL |
| 0.5 mM | 4.97 mL | 24.83 mL | 49.65 mL |
| 1 mM | 2.48 mL | 12.41 mL | 24.83 mL |
| 5 mM | 0.5 mL | 2.48 mL | 4.97 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
