AZD-7648
Catalog No.: A20049
DNA-PK inhibitor
AZD-7648 is a potent and selective DNA-PK inhibitor. Anti-tumor activity.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | AZD-7648 is a potent and selective DNA-PK inhibitor. Anti-tumor activity. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A20049 |
|---|---|
| Formula | C18H20N8O2 |
| Molecular Weight | 380.4 |
| CAS Number | 2230820-11-6 |
| SMILES | CC1=CC2=NC=NN2C=C1NC3=NC=C(N(C)C(N4C5CCOCC5)=O)C4=N3 |
| Synonyms | AZD7648, AZD 7648 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (13.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.29 mL | 131.44 mL | 262.88 mL |
| 0.5 mM | 5.26 mL | 26.29 mL | 52.58 mL |
| 1 mM | 2.63 mL | 13.14 mL | 26.29 mL |
| 5 mM | 0.53 mL | 2.63 mL | 5.26 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2