Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD1080 is a novel GSK3 inhibitor, rescues synaptic plasticity deficits in rodent brain and exhibits peripheral target engagement in humans. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12819 |
|---|---|
| Formula | C19H18N4O2 |
| Molecular Weight | 334.4 |
| CAS Number | 612487-72-6 |
| SMILES | C1COCCN1CC2=CN/C(=C\3/C4=C(C=CC(=C4)C#N)NC3=O)/C=C2 |
| Synonyms | AZD 1080, AZD-1080 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 49 mg/mL (146.54 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 19 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.9 mL | 149.52 mL | 299.04 mL |
| 0.5 mM | 5.98 mL | 29.9 mL | 59.81 mL |
| 1 mM | 2.99 mL | 14.95 mL | 29.9 mL |
| 5 mM | 0.6 mL | 2.99 mL | 5.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
