Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAF312 is a next-generation potent sphingosine 1-phosphate (S1P) receptor agonist, selective for S1P1 and S1P5. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12906 |
|---|---|
| Formula | C29H35F3N2O3 |
| Molecular Weight | 516.6 |
| CAS Number | 1230487-00-9 |
| SMILES | CCC1=C(C=CC(=C1)C(=NOCC2=CC(=C(C=C2)C3CCCCC3)C(F)(F)F)C)CN4CC(C4)C(=O)O |
| Synonyms | Siponimod |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 99 mg/mL (191.63 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 44 mg/mL (85.17 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.36 mL | 96.79 mL | 193.57 mL |
| 0.5 mM | 3.87 mL | 19.36 mL | 38.71 mL |
| 1 mM | 1.94 mL | 9.68 mL | 19.36 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
