Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Barnidipine (Mepirodipine) is an L-type calcium antagonist (CaA) with high affinity for [3H] initrendipine binding sites (Ki=0.21 nmol/l), has selective action against CaA receptors. |
|---|
| Catalog Num | A21940 |
|---|---|
| Formula | C27H29N3O6 |
| Molecular Weight | 491.54 |
| CAS Number | 104713-75-9 |
| SMILES | O=C(C1=C(C)NC(C)=C(C(O[C@@H]2CN(CC3=CC=CC=C3)CC2)=O)[C@H]1C4=CC=CC([N+]([O-])=O)=C4)OC |
| Synonyms | Mepirodipine; YM-09730-5(Free base), YM09730-5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (176.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.34 mL | 101.72 mL | 203.44 mL |
| 0.5 mM | 4.07 mL | 20.34 mL | 40.69 mL |
| 1 mM | 2.03 mL | 10.17 mL | 20.34 mL |
| 5 mM | 0.41 mL | 2.03 mL | 4.07 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
