Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAY41-4109 racemic is a mixture of R-isomer of BAY41-4109 and S-isomer of BAY41-4109. It inhibits hepatitis B virus (HBV) replication in HepG2.2.15 cells without affecting cell growth with IC50 value of 202nM . |
|---|
| Catalog Num | A17163 |
|---|---|
| Formula | C18H13ClF3N3O2 |
| Molecular Weight | 395.8 |
| CAS Number | 298708-79-9 |
| SMILES | FC1=CC(F)=C(C2=NC(C)=C(C(OC)=O)C(C3=CC=C(F)C=C3Cl)N2)N=C1 |
| Synonyms | BAY414109, BAY 414109 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (184.45 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 10 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.27 mL | 126.33 mL | 252.65 mL |
| 0.5 mM | 5.05 mL | 25.27 mL | 50.53 mL |
| 1 mM | 2.53 mL | 12.63 mL | 25.27 mL |
| 5 mM | 0.51 mL | 2.53 mL | 5.05 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
