Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bethanechol is a parasympathomimetic choline carbamate that selectively stimulates muscarinic receptors without any effect on nicotinic receptors. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10180 |
|---|---|
| Formula | C7H17N2O2.Cl |
| Molecular Weight | 196.68 |
| CAS Number | 590-63-6 |
| SMILES | CC(C[N+](C)(C)C)OC(=O)N.[Cl-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 34 mg/mL (172.87 mM) | |
| Water | 34 mg/mL (172.87 mM) | ||
| Ethanol | 34 mg/mL (172.87 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 50.84 mL | 254.22 mL | 508.44 mL |
| 0.5 mM | 10.17 mL | 50.84 mL | 101.69 mL |
| 1 mM | 5.08 mL | 25.42 mL | 50.84 mL |
| 5 mM | 1.02 mL | 5.08 mL | 10.17 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
