Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BI-78D3 is a competitive JNK (c-Jun N-terminal kinases) inhibitor (IC50 = 280 nM) that displays > 100 fold selectivity over p38α and no activity at mTOR and PI-3K. BI 78D3 inhibits JIP1(JNK interacting protein 1)-JNK binding (IC50 = 500 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13683 |
|---|---|
| Formula | C13H9N5O5S2 |
| Molecular Weight | 379 |
| CAS Number | 883065-90-5 |
| SMILES | C1COC2=C(O1)C=CC(=C2)N3C(=O)NN=C3SC4=NC=C(S4)[N+](=O)[O-] |
| Synonyms | BI 78D3, BI78D3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (234.6 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.39 mL | 131.93 mL | 263.85 mL |
| 0.5 mM | 5.28 mL | 26.39 mL | 52.77 mL |
| 1 mM | 2.64 mL | 13.19 mL | 26.39 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
