Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Bikinin is a potent inhibitor of plant GSK-3/Shaggy-like kinase; activates BR signaling downstream of the BR receptor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15526 |
|---|---|
| Formula | C9H9BrN2O3 |
| Molecular Weight | 273.08 |
| CAS Number | 188011-69-0 |
| SMILES | C1=CC(=NC=C1Br)NC(=O)CCC(=O)O |
| Synonyms | Abrasin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (190.42 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.62 mL | 183.1 mL | 366.19 mL |
| 0.5 mM | 7.32 mL | 36.62 mL | 73.24 mL |
| 1 mM | 3.66 mL | 18.31 mL | 36.62 mL |
| 5 mM | 0.73 mL | 3.66 mL | 7.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
