Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | BIX 02189 is a selective dual MEK5 and ERK5 (or BMK1) kinase inhibitor, with IC50 values of 1.5, 59, 580 and >6200 nM for MEK5, ERK5, TGFbR1 and other closely related kinases respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10151 |
|---|---|
| Formula | C27H28N4O2 |
| Molecular Weight | 440.5 |
| CAS Number | 1094614-85-3 |
| SMILES | CN(C)CC1=CC(=CC=C1)N/C(=C\2/C3=C(C=C(C=C3)C(=O)N(C)C)NC2=O)/C4=CC=CC=C4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 56 mg/mL (127.11 mM) | |
| Water | Insoluble | ||
| Ethanol | 75 mg/mL (170.24 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.7 mL | 113.51 mL | 227.01 mL |
| 0.5 mM | 4.54 mL | 22.7 mL | 45.4 mL |
| 1 mM | 2.27 mL | 11.35 mL | 22.7 mL |
| 5 mM | 0.45 mL | 2.27 mL | 4.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
