Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMH-21 is a potent small molecule DNA intercalator. BMH-21 binds ribosomal DNA and inhibits RNA polymerase I (Pol I) transcription. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14335 |
|---|---|
| Formula | C21H20N4O2 |
| Molecular Weight | 360.4 |
| CAS Number | 896705-16-1 |
| SMILES | CN(C)CCNC(=O)C1=CC=CN2C1=NC3=CC4=CC=CC=C4C=C3C2=O |
| Synonyms | BMH21, BMH 21 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 4 mg/mL (11.1 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL (5.54 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.75 mL | 138.73 mL | 277.47 mL |
| 0.5 mM | 5.55 mL | 27.75 mL | 55.49 mL |
| 1 mM | 2.77 mL | 13.87 mL | 27.75 mL |
| 5 mM | 0.55 mL | 2.77 mL | 5.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
