Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMS 599626 is an orally bioavailable inhibitor of the HER1, HER2 and HER4 tyrosine kinases (IC50=22, 32 and 190 nM, respectively) with potential antineoplastic activity. |
|---|
| Catalog Num | A11209 |
|---|---|
| Formula | C27H27FN8O3.HCl |
| Molecular Weight | 567.1 |
| CAS Number | 873837-23-1 |
| SMILES | CC1=C2C(=NC=NN2C=C1NC(=O)OC[C@@H]3COCCN3)NC4=CC5=C(C=C4)N(N=C5)CC6=CC(=CC=C6)F.Cl |
| Synonyms | BMS-599626, BMS599626, AC-480 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 104 mg/mL (196.02 mM) | |
| Water | Insoluble | ||
| Ethanol | 18 mg/mL (33.92 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.63 mL | 88.17 mL | 176.34 mL |
| 0.5 mM | 3.53 mL | 17.63 mL | 35.27 mL |
| 1 mM | 1.76 mL | 8.82 mL | 17.63 mL |
| 5 mM | 0.35 mL | 1.76 mL | 3.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
