Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BTB-1 is a potent, selective and reversible mitotic motor protein Kif18A inhibitor with an IC50 of 1.69 μM. |
|---|
| Catalog Num | A19322 |
|---|---|
| Formula | C12H8ClNO4S |
| Molecular Weight | 297.71 |
| CAS Number | 86030-08-2 |
| SMILES | O=S(C1=CC=C(Cl)C=C1[N+]([O-])=O)(C2=CC=CC=C2)=O |
| Synonyms | BTB1; BTB 1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (198.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (6.71 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.59 mL | 167.95 mL | 335.9 mL |
| 0.5 mM | 6.72 mL | 33.59 mL | 67.18 mL |
| 1 mM | 3.36 mL | 16.79 mL | 33.59 mL |
| 5 mM | 0.67 mL | 3.36 mL | 6.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
