Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | C-178, a covalent inhibitor of STING, binds to Cys91, potently and selectively suppresses the STING responses elicited by distinct bona fide activators in mouse but not human. |
|---|
| Catalog Num | A19049 |
|---|---|
| Formula | C17H10N2O5 |
| Molecular Weight | 322.27 |
| CAS Number | 329198-87-0 |
| SMILES | O=C(C1=CC=C([N+]([O-])=O)O1)NC2=CC=C3C(OC4=CC=CC=C34)=C2 |
| Synonyms | C178; C 178 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 28 mg/mL (86.88 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.03 mL | 155.15 mL | 310.3 mL |
| 0.5 mM | 6.21 mL | 31.03 mL | 62.06 mL |
| 1 mM | 3.1 mL | 15.51 mL | 31.03 mL |
| 5 mM | 0.62 mL | 3.1 mL | 6.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
