C-NH-Boc-C-Bis-(C1-PEG1-PFP) is a PEG-based linker specifically designed for the development of PROTAC (Proteolysis Targeting Chimeras). This compound facilitates the effective conjugation of ligands to E3 ligase, enhancing the selective ubiquitination and degradation of target proteins. Its unique structure promotes water solubility and optimal spatial orientation, making it suitable for various applications in targeted protein degradation research.
C-NH-Boc-C-Bis-(C1-PEG1-PFP) is a PEG-based linker specifically designed for the development of PROTAC (Proteolysis Targeting Chimeras). This compound facilitates the effective conjugation of ligands to E3 ligase, enhancing the selective ubiquitination and degradation of target proteins. Its unique structure promotes water solubility and optimal spatial orientation, making it suitable for various applications in targeted protein degradation research.
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
