Loading distributor info...
| Description | CaCCinh-A01 inhibits CaCC currents in human bronchial and intestinal cells. Also inhibits TMEM16A channels (IC50 = 2.1 uM, in TMEM16A-expressing FRT cells). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A15469 |
|---|---|
| Formula | C18H21NO4S |
| Molecular Weight | 347.43 |
| CAS Number | 407587-33-1 |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=C2C(=O)O)NC(=O)C3=CC=CO3 |
| Synonyms | CaCCinh A01 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (192.84 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (5.75 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.78 mL | 143.91 mL | 287.83 mL |
| 0.5 mM | 5.76 mL | 28.78 mL | 57.57 mL |
| 1 mM | 2.88 mL | 14.39 mL | 28.78 mL |
| 5 mM | 0.58 mL | 2.88 mL | 5.76 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
