Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Calpeptin is a cell permeable calpain inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15295 |
|---|---|
| Formula | C20H30N2O4 |
| Molecular Weight | 362.47 |
| CAS Number | 117591-20-5 |
| SMILES | CCCCC(C=O)NC(=O)C(CC(C)C)NC(=O)OCC1=CC=CC=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (182.09 mM) | |
| Water | Insoluble | ||
| Ethanol | 66 mg/mL (182.09 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.59 mL | 137.94 mL | 275.88 mL |
| 0.5 mM | 5.52 mL | 27.59 mL | 55.18 mL |
| 1 mM | 2.76 mL | 13.79 mL | 27.59 mL |
| 5 mM | 0.55 mL | 2.76 mL | 5.52 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
