Loading distributor info...
| Description | Carboxin is a systemic agricultural fungicide and seed treatment agent. Carboxin kill or inhibit the growth of fungi in agricultural applications. |
|---|
| Catalog Num | A18199 |
|---|---|
| Formula | C12H13NO2S |
| Molecular Weight | 235.3 |
| CAS Number | 5234-68-4 |
| SMILES | O=C(Nc1ccccc1)C2=C(C)OCCS2 |
| Synonyms | Carboxin; CCRIS 5217; Cerevax; D 735; D-735;D735; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (186.99 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.5 mL | 212.49 mL | 424.99 mL |
| 0.5 mM | 8.5 mL | 42.5 mL | 85 mL |
| 1 mM | 4.25 mL | 21.25 mL | 42.5 mL |
| 5 mM | 0.85 mL | 4.25 mL | 8.5 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
