Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | CCT137690 is a highly selective inhibitor of Aurora A, Aurora B and Aurora C with IC50 of 15 nM, 25 nM and 19 nM. It has little effect on hERG ion-channel. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11081 |
|---|---|
| Formula | C26H31BrN8O |
| Molecular Weight | 551.5 |
| CAS Number | 1095382-05-0 |
| SMILES | CC1=CC(=NO1)CN2CCN(CC2)C3=C4C(=NC=C3Br)N=C(N4)C5=CC=C(C=C5)N6CCN(CC6)C |
| Synonyms | CCT-137690 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 4 mg/mL (7.25 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.13 mL | 90.66 mL | 181.32 mL |
| 0.5 mM | 3.63 mL | 18.13 mL | 36.26 mL |
| 1 mM | 1.81 mL | 9.07 mL | 18.13 mL |
| 5 mM | 0.36 mL | 1.81 mL | 3.63 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
