Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cefixime is a third generation cephalosporin antibiotic that is orally active. |
|---|
| Catalog Num | A13697 |
|---|---|
| Formula | C16H15N5O7S2 |
| Molecular Weight | 453.45 |
| CAS Number | 79350-37-1 |
| SMILES | C=CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)/C(=N\OCC(=O)O)/C3=CSC(=N3)N)SC1)C(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (189.65 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (2.2 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.05 mL | 110.27 mL | 220.53 mL |
| 0.5 mM | 4.41 mL | 22.05 mL | 44.11 mL |
| 1 mM | 2.21 mL | 11.03 mL | 22.05 mL |
| 5 mM | 0.44 mL | 2.21 mL | 4.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
