Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cenicriviroc is an experimental drug candidate for the treatment of HIV infection.Cenicriviroc is an inhibitor of CCR2 and CCR5 receptors, allowing it to function as an entry inhibitor which prevents the virus from entering into a human cell. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13643 |
|---|---|
| Formula | C41H52N4O4S |
| Molecular Weight | 696.94 |
| CAS Number | 497223-25-3 |
| SMILES | CCCCOCCOC1=CC=C(C=C1)C2=CC/3=C(C=C2)N(CCC/C(=C3)/C(=O)NC4=CC=C(C=C4)[S@@](=O)CC5=CN=CN5CCC)CC(C)C |
| Synonyms | TAK-652, TBR-652 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (134.87 mM) | |
| Water | Insoluble | ||
| Ethanol | 94 mg/mL (134.87 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.35 mL | 71.74 mL | 143.48 mL |
| 0.5 mM | 2.87 mL | 14.35 mL | 28.7 mL |
| 1 mM | 1.43 mL | 7.17 mL | 14.35 mL |
| 5 mM | 0.29 mL | 1.43 mL | 2.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
